C21H14F3N5O2S — CID 136883475
N-[(Z)-(2-hydroxyphenyl)methylideneamino]-2-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxamide (PubChem CID 136883475) has the molecular formula C21H14F3N5O2S and a molecular weight of 457.44 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxyphenyl)methylideneamino]-2-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(Z)-(2-hydroxyphenyl)methylideneamino]-2-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 136883475 |
| Molecular Formula | C21H14F3N5O2S |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N-[(Z)-(2-hydroxyphenyl)methylideneamino]-2-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(N/N=C\c1ccccc1O)c1csc(-n2nc(C(F)(F)F)cc2-c2ccccc2)n1 |
| InChI | InChI=1S/C21H14F3N5O2S/c22-21(23,24)18-10-16(13-6-2-1-3-7-13)29(28-18)20-26-15(12-32-20)19(31)27-25-11-14-8-4-5-9-17(14)30/h1-12,30H,(H,27,31)/b25-11- |
| InChIKey | KPKSZJVXEUTWBH-GATIEOLUSA-N |
| XLogP | 4.48 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|