C32H48N2O2 — CID 136883588
2-tert-butyl-6-[[[(1R,2R)-2-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methylideneamino]cyclohexyl]-ethylamino]methyl]-4-methylphenol (PubChem CID 136883588) has the molecular formula C32H48N2O2 and a molecular weight of 492.75 g/mol. Its IUPAC name is 2-tert-butyl-6-[[[(1R,2R)-2-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methylideneamino]cyclohexyl]-ethylamino]methyl]-4-methylphenol.
| Compound Name | 2-tert-butyl-6-[[[(1R,2R)-2-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methylideneamino]cyclohexyl]-ethylamino]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 136883588 |
| Molecular Formula | C32H48N2O2 |
| Molecular Weight | 492.75 g/mol |
| Exact Mass | 492.37 |
| IUPAC Name | 2-tert-butyl-6-[[[(1R,2R)-2-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methylideneamino]cyclohexyl]-ethylamino]methyl]-4-methylphenol |
| SMILES | CCN(Cc1cc(C)cc(C(C)(C)C)c1O)[C@@H]1CCCC[C@H]1/N=C/c1cc(C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C32H48N2O2/c1-10-34(20-24-16-22(3)18-26(30(24)36)32(7,8)9)28-14-12-11-13-27(28)33-19-23-15-21(2)17-25(29(23)35)31(4,5)6/h15-19,27-28,35-36H,10-14,20H2,1-9H3/b33-19+/t27-,28-/m1/s1 |
| InChIKey | DYWVIRIIGCILRS-GGFGSRELSA-N |
| XLogP | 7.56 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.75 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|