C22H20N2O5 — CID 136883770
[(3S)-3-(3,5-dimethoxyphenyl)-5-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]-(furan-2-yl)methanone (PubChem CID 136883770) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is [(3S)-3-(3,5-dimethoxyphenyl)-5-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]-(furan-2-yl)methanone.
| Compound Name | [(3S)-3-(3,5-dimethoxyphenyl)-5-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 136883770 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [(3S)-3-(3,5-dimethoxyphenyl)-5-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]-(furan-2-yl)methanone |
| SMILES | COc1cc(OC)cc([C@@H]2CC(c3ccccc3O)=NN2C(=O)c2ccco2)c1 |
| InChI | InChI=1S/C22H20N2O5/c1-27-15-10-14(11-16(12-15)28-2)19-13-18(17-6-3-4-7-20(17)25)23-24(19)22(26)21-8-5-9-29-21/h3-12,19,25H,13H2,1-2H3/t19-/m0/s1 |
| InChIKey | GWLNWFIJSMSBIF-IBGZPJMESA-N |
| XLogP | 3.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|