C17H14I2N2O3 — CID 136883895
(1S,2R,6S,7S)-4-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 136883895) has the molecular formula C17H14I2N2O3 and a molecular weight of 548.12 g/mol. Its IUPAC name is (1S,2R,6S,7S)-4-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7S)-4-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 136883895 |
| Molecular Formula | C17H14I2N2O3 |
| Molecular Weight | 548.12 g/mol |
| Exact Mass | 547.91 |
| IUPAC Name | (1S,2R,6S,7S)-4-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1/N=C\c1cc(I)c(O)c(I)c1)[C@@H]1C=C[C@@H]2CC1 |
| InChI | InChI=1S/C17H14I2N2O3/c18-11-5-8(6-12(19)15(11)22)7-20-21-16(23)13-9-1-2-10(4-3-9)14(13)17(21)24/h1-2,5-7,9-10,13-14,22H,3-4H2/b20-7-/t9-,10-,13-,14+/m1/s1 |
| InChIKey | IAAJMWNGHISLOM-OZFOQWSUSA-N |
| XLogP | 3.13 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.12 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|