C18H19BrN4O3S — CID 136884996
(5R)-N-(4-bromo-2-methylphenyl)-4,7-dioxo-2-propylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136884996) has the molecular formula C18H19BrN4O3S and a molecular weight of 451.35 g/mol. Its IUPAC name is (5R)-N-(4-bromo-2-methylphenyl)-4,7-dioxo-2-propylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-N-(4-bromo-2-methylphenyl)-4,7-dioxo-2-propylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136884996 |
| Molecular Formula | C18H19BrN4O3S |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | (5R)-N-(4-bromo-2-methylphenyl)-4,7-dioxo-2-propylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CCCSc1nc2c(c(=O)[nH]1)[C@H](C(=O)Nc1ccc(Br)cc1C)CC(=O)N2 |
| InChI | InChI=1S/C18H19BrN4O3S/c1-3-6-27-18-22-15-14(17(26)23-18)11(8-13(24)21-15)16(25)20-12-5-4-10(19)7-9(12)2/h4-5,7,11H,3,6,8H2,1-2H3,(H,20,25)(H2,21,22,23,24,26)/t11-/m1/s1 |
| InChIKey | CMRMBVHEHMKKGD-LLVKDONJSA-N |
| XLogP | 3.41 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |