C15H11BrN2O2S — CID 136885829
4-bromo-2-[3-(4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136885829) has the molecular formula C15H11BrN2O2S and a molecular weight of 363.24 g/mol. Its IUPAC name is 4-bromo-2-[3-(4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 4-bromo-2-[3-(4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136885829 |
| Molecular Formula | C15H11BrN2O2S |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 4-bromo-2-[3-(4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | CSc1ccc(-c2noc(-c3cc(Br)ccc3O)n2)cc1 |
| InChI | InChI=1S/C15H11BrN2O2S/c1-21-11-5-2-9(3-6-11)14-17-15(20-18-14)12-8-10(16)4-7-13(12)19/h2-8,19H,1H3 |
| InChIKey | JMSVPIHTDNATRJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |