C27H26BrN5O3S — CID 136886939
2-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]acetamide (PubChem CID 136886939) has the molecular formula C27H26BrN5O3S and a molecular weight of 580.51 g/mol. Its IUPAC name is 2-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 136886939 |
| Molecular Formula | C27H26BrN5O3S |
| Molecular Weight | 580.51 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | 2-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]acetamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)CSc2nc3ccccc3c(=O)n2-c2ccc(Br)cc2)c(O)c1 |
| InChI | InChI=1S/C27H26BrN5O3S/c1-3-32(4-2)21-12-9-18(24(34)15-21)16-29-31-25(35)17-37-27-30-23-8-6-5-7-22(23)26(36)33(27)20-13-10-19(28)11-14-20/h5-16,34H,3-4,17H2,1-2H3,(H,31,35)/b29-16- |
| InChIKey | HWDRRDVQPGFTFH-MWLSYYOVSA-N |
| XLogP | 4.94 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|