C14H17N3O3 — CID 136889000
4-[5-(4-methylpiperidin-4-yl)-1,2,4-oxadiazol-3-yl]benzene-1,2-diol (PubChem CID 136889000) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-[5-(4-methylpiperidin-4-yl)-1,2,4-oxadiazol-3-yl]benzene-1,2-diol.
| Compound Name | 4-[5-(4-methylpiperidin-4-yl)-1,2,4-oxadiazol-3-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136889000 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-[5-(4-methylpiperidin-4-yl)-1,2,4-oxadiazol-3-yl]benzene-1,2-diol |
| SMILES | CC1(c2nc(-c3ccc(O)c(O)c3)no2)CCNCC1 |
| InChI | InChI=1S/C14H17N3O3/c1-14(4-6-15-7-5-14)13-16-12(17-20-13)9-2-3-10(18)11(19)8-9/h2-3,8,15,18-19H,4-7H2,1H3 |
| InChIKey | CTIXBWPTJDYCOY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|