C11H12N2O2S — CID 136889178
4-[4-(1-aminoethyl)-1,3-thiazol-2-yl]benzene-1,2-diol (PubChem CID 136889178) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 4-[4-(1-aminoethyl)-1,3-thiazol-2-yl]benzene-1,2-diol.
| Compound Name | 4-[4-(1-aminoethyl)-1,3-thiazol-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136889178 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 4-[4-(1-aminoethyl)-1,3-thiazol-2-yl]benzene-1,2-diol |
| SMILES | CC(N)c1csc(-c2ccc(O)c(O)c2)n1 |
| InChI | InChI=1S/C11H12N2O2S/c1-6(12)8-5-16-11(13-8)7-2-3-9(14)10(15)4-7/h2-6,14-15H,12H2,1H3 |
| InChIKey | MQWXIVSENUHPSX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|