2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid

C14H14N2O4 — CID 136889195

IUPAC2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid
SMILESCCCc1nc(-c2ccc(O)c(O)c2)ncc1C(=O)O
InChIInChI=1S/C14H14N2O4/c1-2-3-10-9(14(19)20)7-15-13(16-10)8-4-5-11(17)12(18)6-8/h4-7,17-18H,2-3H2,1H3,(H,19,20)
InChIKeyPFWUCPWIFMTBEZ-UHFFFAOYSA-N
MW274.28 g/mol
LogP2.21
Rot. Bonds4

About 2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid

2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid (PubChem CID 136889195) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid.

Molecular Properties

Compound Name2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid
PubChem CID136889195
Molecular FormulaC14H14N2O4
Molecular Weight274.28 g/mol
Exact Mass274.10
IUPAC Name2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid
SMILESCCCc1nc(-c2ccc(O)c(O)c2)ncc1C(=O)O
InChIInChI=1S/C14H14N2O4/c1-2-3-10-9(14(19)20)7-15-13(16-10)8-4-5-11(17)12(18)6-8/h4-7,17-18H,2-3H2,1H3,(H,19,20)
InChIKeyPFWUCPWIFMTBEZ-UHFFFAOYSA-N
XLogP2.21
TPSA103.54 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.28
LogP ≤ 52.21
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze 2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid?
The IUPAC name of 2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid (CID 136889195) is 2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid.
What is the SMILES notation for 2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid?
The canonical SMILES for 2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid is CCCc1nc(-c2ccc(O)c(O)c2)ncc1C(=O)O.
What is the InChIKey of 2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid?
The InChIKey is PFWUCPWIFMTBEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O4/c1-2-3-10-9(14(19)20)7-15-13(16-10)8-4-5-11(17)12(18)6-8/h4-7,17-18H,2-3H2,1H3,(H,19,20).
What are the key properties of 2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid?
2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid has a molecular weight of 274.28 g/mol, XLogP of 2.21, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydroxyphenyl)-4-propylpyrimidine-5-carboxylic acid is sourced from PubChem (CID 136889195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).