C15H17N3O2 — CID 136889223
4-[5-(methylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]benzene-1,2-diol (PubChem CID 136889223) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-[5-(methylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]benzene-1,2-diol.
| Compound Name | 4-[5-(methylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136889223 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 4-[5-(methylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]benzene-1,2-diol |
| SMILES | CNC1CCCc2nc(-c3ccc(O)c(O)c3)ncc21 |
| InChI | InChI=1S/C15H17N3O2/c1-16-11-3-2-4-12-10(11)8-17-15(18-12)9-5-6-13(19)14(20)7-9/h5-8,11,16,19-20H,2-4H2,1H3 |
| InChIKey | AGVQWXNORQBIHE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|