C16H18N2O2S — CID 136889330
4-[4-cyclopropyl-5-[(cyclopropylamino)methyl]-1,3-thiazol-2-yl]benzene-1,2-diol (PubChem CID 136889330) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-[4-cyclopropyl-5-[(cyclopropylamino)methyl]-1,3-thiazol-2-yl]benzene-1,2-diol.
| Compound Name | 4-[4-cyclopropyl-5-[(cyclopropylamino)methyl]-1,3-thiazol-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136889330 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 4-[4-cyclopropyl-5-[(cyclopropylamino)methyl]-1,3-thiazol-2-yl]benzene-1,2-diol |
| SMILES | Oc1ccc(-c2nc(C3CC3)c(CNC3CC3)s2)cc1O |
| InChI | InChI=1S/C16H18N2O2S/c19-12-6-3-10(7-13(12)20)16-18-15(9-1-2-9)14(21-16)8-17-11-4-5-11/h3,6-7,9,11,17,19-20H,1-2,4-5,8H2 |
| InChIKey | NVNBGUDCOCGCKG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|