C14H17N3O2 — CID 136889447
4-[5-(2-aminobutyl)pyrimidin-2-yl]benzene-1,2-diol (PubChem CID 136889447) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-[5-(2-aminobutyl)pyrimidin-2-yl]benzene-1,2-diol.
| Compound Name | 4-[5-(2-aminobutyl)pyrimidin-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136889447 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 4-[5-(2-aminobutyl)pyrimidin-2-yl]benzene-1,2-diol |
| SMILES | CCC(N)Cc1cnc(-c2ccc(O)c(O)c2)nc1 |
| InChI | InChI=1S/C14H17N3O2/c1-2-11(15)5-9-7-16-14(17-8-9)10-3-4-12(18)13(19)6-10/h3-4,6-8,11,18-19H,2,5,15H2,1H3 |
| InChIKey | IRAWNRNIAYUVSI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|