About 4H-pyrrolo[3,2-f]quinoxalin-1-ium
4H-pyrrolo[3,2-f]quinoxalin-1-ium (PubChem CID 136890035) has the molecular formula C10H8N3+
and a molecular weight of 170.19 g/mol. Its IUPAC name is 4H-pyrrolo[3,2-f]quinoxalin-1-ium.
Molecular Properties
| Compound Name | 4H-pyrrolo[3,2-f]quinoxalin-1-ium |
| PubChem CID | 136890035 |
| Molecular Formula | C10H8N3+ |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 4H-pyrrolo[3,2-f]quinoxalin-1-ium |
| SMILES | c1cc2c(ccc3[nH]cc[nH+]c32)n1 |
| InChI | InChI=1S/C10H7N3/c1-2-9-10(13-6-5-12-9)7-3-4-11-8(1)7/h1-6,12H/p+1 |
| InChIKey | RMIFGSLDMMIENP-UHFFFAOYSA-O |
| XLogP | 1.53 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4H-pyrrolo[3,2-f]quinoxalin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrrolo[3,2-f]quinoxalin-1-ium?
The IUPAC name of 4H-pyrrolo[3,2-f]quinoxalin-1-ium (CID 136890035) is 4H-pyrrolo[3,2-f]quinoxalin-1-ium.
What is the SMILES notation for 4H-pyrrolo[3,2-f]quinoxalin-1-ium?
The canonical SMILES for 4H-pyrrolo[3,2-f]quinoxalin-1-ium is c1cc2c(ccc3[nH]cc[nH+]c32)n1.
What is the InChIKey of 4H-pyrrolo[3,2-f]quinoxalin-1-ium?
The InChIKey is RMIFGSLDMMIENP-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H7N3/c1-2-9-10(13-6-5-12-9)7-3-4-11-8(1)7/h1-6,12H/p+1.
What are the key properties of 4H-pyrrolo[3,2-f]quinoxalin-1-ium?
4H-pyrrolo[3,2-f]quinoxalin-1-ium has a molecular weight of 170.19 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrrolo[3,2-f]quinoxalin-1-ium is sourced from PubChem (CID 136890035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).