C10H12F4N2O3 — CID 136890417
4-(methoxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890417) has the molecular formula C10H12F4N2O3 and a molecular weight of 284.21 g/mol. Its IUPAC name is 4-(methoxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(methoxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136890417 |
| Molecular Formula | C10H12F4N2O3 |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(methoxymethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | COCc1cc(=O)[nH]c(COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C10H12F4N2O3/c1-18-3-6-2-8(17)16-7(15-6)4-19-5-10(13,14)9(11)12/h2,9H,3-5H2,1H3,(H,15,16,17) |
| InChIKey | IHJJVBFZENAWAT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|