C12H16F4N2O2 — CID 136890419
4-methyl-5-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890419) has the molecular formula C12H16F4N2O2 and a molecular weight of 296.26 g/mol. Its IUPAC name is 4-methyl-5-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-methyl-5-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136890419 |
| Molecular Formula | C12H16F4N2O2 |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-methyl-5-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(COCC(F)(F)C(F)F)[nH]c(=O)c1C(C)C |
| InChI | InChI=1S/C12H16F4N2O2/c1-6(2)9-7(3)17-8(18-10(9)19)4-20-5-12(15,16)11(13)14/h6,11H,4-5H2,1-3H3,(H,17,18,19) |
| InChIKey | XIEGIDQHXPCBMT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|