About 5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one
5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890431) has the molecular formula C8H8F3IN2O2
and a molecular weight of 348.06 g/mol. Its IUPAC name is 5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one |
| PubChem CID | 136890431 |
| Molecular Formula | C8H8F3IN2O2 |
| Molecular Weight | 348.06 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(COCC(F)(F)F)[nH]c(=O)c1I |
| InChI | InChI=1S/C8H8F3IN2O2/c1-4-6(12)7(15)14-5(13-4)2-16-3-8(9,10)11/h2-3H2,1H3,(H,13,14,15) |
| InChIKey | JSEGLQWTRDZSAH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.06 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one?
The IUPAC name of 5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one (CID 136890431) is 5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one is Cc1nc(COCC(F)(F)F)[nH]c(=O)c1I.
What is the InChIKey of 5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one?
The InChIKey is JSEGLQWTRDZSAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3IN2O2/c1-4-6(12)7(15)14-5(13-4)2-16-3-8(9,10)11/h2-3H2,1H3,(H,13,14,15).
What are the key properties of 5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one?
5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one has a molecular weight of 348.06 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-4-methyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 136890431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).