C12H15F3N2O2 — CID 136890462
4-cyclopentyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890462) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 4-cyclopentyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-cyclopentyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136890462 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-cyclopentyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C2CCCC2)nc(COCC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C12H15F3N2O2/c13-12(14,15)7-19-6-10-16-9(5-11(18)17-10)8-3-1-2-4-8/h5,8H,1-4,6-7H2,(H,16,17,18) |
| InChIKey | BXCSVYSUMRMJRL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |