C10H11F4N3O4 — CID 136890473
2-[4-amino-6-oxo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-5-yl]acetic acid (PubChem CID 136890473) has the molecular formula C10H11F4N3O4 and a molecular weight of 313.21 g/mol. Its IUPAC name is 2-[4-amino-6-oxo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[4-amino-6-oxo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136890473 |
| Molecular Formula | C10H11F4N3O4 |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[4-amino-6-oxo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-5-yl]acetic acid |
| SMILES | Nc1nc(COCC(F)(F)C(F)F)[nH]c(=O)c1CC(=O)O |
| InChI | InChI=1S/C10H11F4N3O4/c11-9(12)10(13,14)3-21-2-5-16-7(15)4(1-6(18)19)8(20)17-5/h9H,1-3H2,(H,18,19)(H3,15,16,17,20) |
| InChIKey | ZAPUXLDJKZWGBK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|