C10H13F4N3O2 — CID 136890489
4-(2-aminoethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890489) has the molecular formula C10H13F4N3O2 and a molecular weight of 283.22 g/mol. Its IUPAC name is 4-(2-aminoethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(2-aminoethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136890489 |
| Molecular Formula | C10H13F4N3O2 |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-(2-aminoethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | NCCc1cc(=O)[nH]c(COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C10H13F4N3O2/c11-9(12)10(13,14)5-19-4-7-16-6(1-2-15)3-8(18)17-7/h3,9H,1-2,4-5,15H2,(H,16,17,18) |
| InChIKey | LSRCOHXMJMMOFF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|