C18H17N5O — CID 136890617
(4R)-4-(2-prop-2-enoxyphenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine (PubChem CID 136890617) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is (4R)-4-(2-prop-2-enoxyphenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine.
| Compound Name | (4R)-4-(2-prop-2-enoxyphenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
|---|---|
| PubChem CID | 136890617 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (4R)-4-(2-prop-2-enoxyphenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
| SMILES | C=CCOc1ccccc1[C@@H]1N=C(N)Nc2nc3ccccc3n21 |
| InChI | InChI=1S/C18H17N5O/c1-2-11-24-15-10-6-3-7-12(15)16-21-17(19)22-18-20-13-8-4-5-9-14(13)23(16)18/h2-10,16H,1,11H2,(H3,19,20,21,22)/t16-/m1/s1 |
| InChIKey | YMKFCLSWIMJRHX-MRXNPFEDSA-N |
| XLogP | 2.89 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|