C16H22ClN5O2 — CID 136891550
4-[(2R)-1-(4-chloropyrazol-1-yl)propan-2-yl]-2-(oxan-4-ylmethylamino)-1H-pyrimidin-6-one (PubChem CID 136891550) has the molecular formula C16H22ClN5O2 and a molecular weight of 351.84 g/mol. Its IUPAC name is 4-[(2R)-1-(4-chloropyrazol-1-yl)propan-2-yl]-2-(oxan-4-ylmethylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-[(2R)-1-(4-chloropyrazol-1-yl)propan-2-yl]-2-(oxan-4-ylmethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136891550 |
| Molecular Formula | C16H22ClN5O2 |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 4-[(2R)-1-(4-chloropyrazol-1-yl)propan-2-yl]-2-(oxan-4-ylmethylamino)-1H-pyrimidin-6-one |
| SMILES | C[C@H](Cn1cc(Cl)cn1)c1cc(=O)[nH]c(NCC2CCOCC2)n1 |
| InChI | InChI=1S/C16H22ClN5O2/c1-11(9-22-10-13(17)8-19-22)14-6-15(23)21-16(20-14)18-7-12-2-4-24-5-3-12/h6,8,10-12H,2-5,7,9H2,1H3,(H2,18,20,21,23)/t11-/m1/s1 |
| InChIKey | RHJVSCBSZDJCKG-LLVKDONJSA-N |
| XLogP | 2.26 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |