C19H14N4O2S — CID 136892719
(5Z)-5-[(6-methoxyquinolin-2-yl)methylidene]-2-pyridin-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 136892719) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is (5Z)-5-[(6-methoxyquinolin-2-yl)methylidene]-2-pyridin-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(6-methoxyquinolin-2-yl)methylidene]-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136892719 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (5Z)-5-[(6-methoxyquinolin-2-yl)methylidene]-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2nc(/C=C3\SC(=Nc4ccccn4)NC3=O)ccc2c1 |
| InChI | InChI=1S/C19H14N4O2S/c1-25-14-7-8-15-12(10-14)5-6-13(21-15)11-16-18(24)23-19(26-16)22-17-4-2-3-9-20-17/h2-11H,1H3,(H,20,22,23,24)/b16-11- |
| InChIKey | JTIGPNHPWOVEJV-WJDWOHSUSA-N |
| XLogP | 3.53 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|