C24H23N5O3 — CID 136892922
(8R,9S)-8-(1,3-benzodioxol-5-yl)-4-tert-butyl-10-phenyl-2,4,5,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5-trien-11-one (PubChem CID 136892922) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is (8R,9S)-8-(1,3-benzodioxol-5-yl)-4-tert-butyl-10-phenyl-2,4,5,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5-trien-11-one.
| Compound Name | (8R,9S)-8-(1,3-benzodioxol-5-yl)-4-tert-butyl-10-phenyl-2,4,5,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5-trien-11-one |
|---|---|
| PubChem CID | 136892922 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | (8R,9S)-8-(1,3-benzodioxol-5-yl)-4-tert-butyl-10-phenyl-2,4,5,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5-trien-11-one |
| SMILES | CC(C)(C)n1ncc2c1N=C1NC(=O)N(c3ccccc3)[C@H]1[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H23N5O3/c1-24(2,3)29-22-16(12-25-29)19(14-9-10-17-18(11-14)32-13-31-17)20-21(26-22)27-23(30)28(20)15-7-5-4-6-8-15/h4-12,19-20H,13H2,1-3H3,(H,26,27,30)/t19-,20+/m1/s1 |
| InChIKey | HBHUFCORSPOXHF-UXHICEINSA-N |
| XLogP | 4.14 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |