C26H27N5O5 — CID 136892965
(8R,9S)-4-tert-butyl-8-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-10-phenyl-2,4,5,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5-trien-11-one (PubChem CID 136892965) has the molecular formula C26H27N5O5 and a molecular weight of 489.53 g/mol. Its IUPAC name is (8R,9S)-4-tert-butyl-8-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-10-phenyl-2,4,5,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5-trien-11-one.
| Compound Name | (8R,9S)-4-tert-butyl-8-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-10-phenyl-2,4,5,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5-trien-11-one |
|---|---|
| PubChem CID | 136892965 |
| Molecular Formula | C26H27N5O5 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | (8R,9S)-4-tert-butyl-8-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-10-phenyl-2,4,5,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5-trien-11-one |
| SMILES | COc1cc([C@H]2c3cnn(C(C)(C)C)c3N=C3NC(=O)N(c4ccccc4)[C@H]32)c(OC)c2c1OCO2 |
| InChI | InChI=1S/C26H27N5O5/c1-26(2,3)31-24-16(12-27-31)18(15-11-17(33-4)21-22(20(15)34-5)36-13-35-21)19-23(28-24)29-25(32)30(19)14-9-7-6-8-10-14/h6-12,18-19H,13H2,1-5H3,(H,28,29,32)/t18-,19-/m0/s1 |
| InChIKey | IJCFBPGPJOLKPS-OALUTQOASA-N |
| XLogP | 4.16 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |