About (4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one
(4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one (PubChem CID 136893179) has the molecular formula C14H8F2N2OS
and a molecular weight of 290.29 g/mol. Its IUPAC name is (4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one.
Molecular Properties
| Compound Name | (4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one |
| PubChem CID | 136893179 |
| Molecular Formula | C14H8F2N2OS |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | (4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccc(F)c(F)c2)=N/C1=C/c1cccs1 |
| InChI | InChI=1S/C14H8F2N2OS/c15-10-4-3-8(6-11(10)16)13-17-12(14(19)18-13)7-9-2-1-5-20-9/h1-7H,(H,17,18,19)/b12-7+ |
| InChIKey | MZZBGJFHKLDSCM-KPKJPENVSA-N |
| XLogP | 2.94 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one?
The IUPAC name of (4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one (CID 136893179) is (4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one.
What is the SMILES notation for (4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one?
The canonical SMILES for (4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one is O=C1NC(c2ccc(F)c(F)c2)=N/C1=C/c1cccs1.
What is the InChIKey of (4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one?
The InChIKey is MZZBGJFHKLDSCM-KPKJPENVSA-N. The full InChI is InChI=1S/C14H8F2N2OS/c15-10-4-3-8(6-11(10)16)13-17-12(14(19)18-13)7-9-2-1-5-20-9/h1-7H,(H,17,18,19)/b12-7+.
What are the key properties of (4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one?
(4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one has a molecular weight of 290.29 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-2-(3,4-difluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one is sourced from PubChem (CID 136893179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).