C21H22N2O6 — CID 136894842
(4Z)-2-(3,5-dimethoxyphenyl)-4-[(2,4,5-trimethoxyphenyl)methylidene]-1H-imidazol-5-one (PubChem CID 136894842) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is (4Z)-2-(3,5-dimethoxyphenyl)-4-[(2,4,5-trimethoxyphenyl)methylidene]-1H-imidazol-5-one.
| Compound Name | (4Z)-2-(3,5-dimethoxyphenyl)-4-[(2,4,5-trimethoxyphenyl)methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136894842 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (4Z)-2-(3,5-dimethoxyphenyl)-4-[(2,4,5-trimethoxyphenyl)methylidene]-1H-imidazol-5-one |
| SMILES | COc1cc(OC)cc(C2=N/C(=C\c3cc(OC)c(OC)cc3OC)C(=O)N2)c1 |
| InChI | InChI=1S/C21H22N2O6/c1-25-14-6-13(7-15(10-14)26-2)20-22-16(21(24)23-20)8-12-9-18(28-4)19(29-5)11-17(12)27-3/h6-11H,1-5H3,(H,22,23,24)/b16-8- |
| InChIKey | JBBISVPIEMXASP-PXNMLYILSA-N |
| XLogP | 2.65 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|