C22H22N4O2 — CID 136895970
2-[2-[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]ethyl]-3H-quinazolin-4-one (PubChem CID 136895970) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[2-[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[2-[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136895970 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-[2-[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]ethyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CCN2CCCC(c3nc4ccccc4o3)C2)nc2ccccc12 |
| InChI | InChI=1S/C22H22N4O2/c27-21-16-7-1-2-8-17(16)23-20(25-21)11-13-26-12-5-6-15(14-26)22-24-18-9-3-4-10-19(18)28-22/h1-4,7-10,15H,5-6,11-14H2,(H,23,25,27) |
| InChIKey | MZAGTIINWNRUNK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |