C10H17IN4O2 — CID 136896841
4-[2-[2-(dimethylamino)ethoxy]ethylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136896841) has the molecular formula C10H17IN4O2 and a molecular weight of 352.18 g/mol. Its IUPAC name is 4-[2-[2-(dimethylamino)ethoxy]ethylamino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-[2-(dimethylamino)ethoxy]ethylamino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136896841 |
| Molecular Formula | C10H17IN4O2 |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 4-[2-[2-(dimethylamino)ethoxy]ethylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CN(C)CCOCCNc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C10H17IN4O2/c1-15(2)4-6-17-5-3-12-9-8(11)10(16)14-7-13-9/h7H,3-6H2,1-2H3,(H2,12,13,14,16) |
| InChIKey | SNEDLXRICLUWJL-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|