About CID 136897725
CID 136897725 (PubChem CID 136897725) has the molecular formula C30H24O2Si4
and a molecular weight of 528.86 g/mol.
Molecular Properties
| Compound Name | CID 136897725 |
| PubChem CID | 136897725 |
| Molecular Formula | C30H24O2Si4 |
| Molecular Weight | 528.86 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | — |
| SMILES | CC1(C)c2ccc3cc2Oc2c(cccc21)[Si][Si]c1cccc2c1Oc1cc(ccc1C2(C)C)[Si][Si]3 |
| InChI | InChI=1S/C30H24O2Si4/c1-29(2)19-13-11-17-15-23(19)31-27-21(29)7-5-9-25(27)35-36-26-10-6-8-22-28(26)32-24-16-18(34-33-17)12-14-20(24)30(22,3)4/h5-16H,1-4H3 |
| InChIKey | FTBIIYBNCCVFEF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.86 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136897725 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136897725?
The IUPAC name of CID 136897725 (CID 136897725) is not available.
What is the SMILES notation for CID 136897725?
The canonical SMILES for CID 136897725 is CC1(C)c2ccc3cc2Oc2c(cccc21)[Si][Si]c1cccc2c1Oc1cc(ccc1C2(C)C)[Si][Si]3.
What is the InChIKey of CID 136897725?
The InChIKey is FTBIIYBNCCVFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24O2Si4/c1-29(2)19-13-11-17-15-23(19)31-27-21(29)7-5-9-25(27)35-36-26-10-6-8-22-28(26)32-24-16-18(34-33-17)12-14-20(24)30(22,3)4/h5-16H,1-4H3.
What are the key properties of CID 136897725?
CID 136897725 has a molecular weight of 528.86 g/mol, XLogP of 3.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136897725 is sourced from PubChem (CID 136897725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).