About CID 136898859
CID 136898859 (PubChem CID 136898859) has the molecular formula C7H8O4Si2
and a molecular weight of 212.31 g/mol.
Molecular Properties
| Compound Name | CID 136898859 |
| PubChem CID | 136898859 |
| Molecular Formula | C7H8O4Si2 |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | — |
| SMILES | COC(=O)C1=C(C(=O)OC)[Si]C[Si]1 |
| InChI | InChI=1S/C7H8O4Si2/c1-10-6(8)4-5(7(9)11-2)13-3-12-4/h3H2,1-2H3 |
| InChIKey | GBAIXGPLHWXDJX-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136898859 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136898859?
The IUPAC name of CID 136898859 (CID 136898859) is not available.
What is the SMILES notation for CID 136898859?
The canonical SMILES for CID 136898859 is COC(=O)C1=C(C(=O)OC)[Si]C[Si]1.
What is the InChIKey of CID 136898859?
The InChIKey is GBAIXGPLHWXDJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4Si2/c1-10-6(8)4-5(7(9)11-2)13-3-12-4/h3H2,1-2H3.
What are the key properties of CID 136898859?
CID 136898859 has a molecular weight of 212.31 g/mol, XLogP of -0.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136898859 is sourced from PubChem (CID 136898859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).