C16H20N4O — CID 136899036
2-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-ylmethyl)-3H-quinazolin-4-one (PubChem CID 136899036) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-ylmethyl)-3H-quinazolin-4-one.
| Compound Name | 2-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-ylmethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136899036 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-ylmethyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CN2CCCC3CNCC32)nc2ccccc12 |
| InChI | InChI=1S/C16H20N4O/c21-16-12-5-1-2-6-13(12)18-15(19-16)10-20-7-3-4-11-8-17-9-14(11)20/h1-2,5-6,11,14,17H,3-4,7-10H2,(H,18,19,21) |
| InChIKey | XZNBBRACBZKLGL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |