C24H28N4O5 — CID 136899122
3-[(7S)-7-(2,4-dimethoxyphenyl)-5-(3,4-dimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]propan-1-ol (PubChem CID 136899122) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is 3-[(7S)-7-(2,4-dimethoxyphenyl)-5-(3,4-dimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]propan-1-ol.
| Compound Name | 3-[(7S)-7-(2,4-dimethoxyphenyl)-5-(3,4-dimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 136899122 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-[(7S)-7-(2,4-dimethoxyphenyl)-5-(3,4-dimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]propan-1-ol |
| SMILES | COc1ccc([C@@H]2C=C(c3ccc(OC)c(OC)c3)Nc3nc(CCCO)nn32)c(OC)c1 |
| InChI | InChI=1S/C24H28N4O5/c1-30-16-8-9-17(21(13-16)32-3)19-14-18(15-7-10-20(31-2)22(12-15)33-4)25-24-26-23(6-5-11-29)27-28(19)24/h7-10,12-14,19,29H,5-6,11H2,1-4H3,(H,25,26,27)/t19-/m0/s1 |
| InChIKey | XNIOUASRVPTDGB-IBGZPJMESA-N |
| XLogP | 3.29 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |