C20H30N4O4S — CID 136899429
2-[(2R)-1-[(1S,2R)-2-methylcyclopropanecarbonyl]piperidin-2-yl]-7-propan-2-ylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 136899429) has the molecular formula C20H30N4O4S and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-[(2R)-1-[(1S,2R)-2-methylcyclopropanecarbonyl]piperidin-2-yl]-7-propan-2-ylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[(2R)-1-[(1S,2R)-2-methylcyclopropanecarbonyl]piperidin-2-yl]-7-propan-2-ylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136899429 |
| Molecular Formula | C20H30N4O4S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[(2R)-1-[(1S,2R)-2-methylcyclopropanecarbonyl]piperidin-2-yl]-7-propan-2-ylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | CC(C)S(=O)(=O)N1CCc2c(nc([C@H]3CCCCN3C(=O)[C@H]3C[C@H]3C)[nH]c2=O)C1 |
| InChI | InChI=1S/C20H30N4O4S/c1-12(2)29(27,28)23-9-7-14-16(11-23)21-18(22-19(14)25)17-6-4-5-8-24(17)20(26)15-10-13(15)3/h12-13,15,17H,4-11H2,1-3H3,(H,21,22,25)/t13-,15+,17-/m1/s1 |
| InChIKey | BQQCLFREWCQMGF-UKPHBRMFSA-N |
| XLogP | 1.58 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |