C26H21N7O3 — CID 136899750
[4-[(4S)-3-methyl-6-oxo-1-(7H-purin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-4-yl]phenyl] 2-phenylacetate (PubChem CID 136899750) has the molecular formula C26H21N7O3 and a molecular weight of 479.50 g/mol. Its IUPAC name is [4-[(4S)-3-methyl-6-oxo-1-(7H-purin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-4-yl]phenyl] 2-phenylacetate.
| Compound Name | [4-[(4S)-3-methyl-6-oxo-1-(7H-purin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-4-yl]phenyl] 2-phenylacetate |
|---|---|
| PubChem CID | 136899750 |
| Molecular Formula | C26H21N7O3 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | [4-[(4S)-3-methyl-6-oxo-1-(7H-purin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-4-yl]phenyl] 2-phenylacetate |
| SMILES | Cc1nn(-c2ncnc3nc[nH]c23)c2c1[C@H](c1ccc(OC(=O)Cc3ccccc3)cc1)CC(=O)N2 |
| InChI | InChI=1S/C26H21N7O3/c1-15-22-19(17-7-9-18(10-8-17)36-21(35)11-16-5-3-2-4-6-16)12-20(34)31-25(22)33(32-15)26-23-24(28-13-27-23)29-14-30-26/h2-10,13-14,19H,11-12H2,1H3,(H,31,34)(H,27,28,29,30)/t19-/m0/s1 |
| InChIKey | HPLXFNLEYXUIPV-IBGZPJMESA-N |
| XLogP | 3.47 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|