C17H12F3N3O2 — CID 136899800
(4S)-1-(furan-2-ylmethyl)-4-(2,3,4-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136899800) has the molecular formula C17H12F3N3O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is (4S)-1-(furan-2-ylmethyl)-4-(2,3,4-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4S)-1-(furan-2-ylmethyl)-4-(2,3,4-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136899800 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (4S)-1-(furan-2-ylmethyl)-4-(2,3,4-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | O=C1C[C@H](c2ccc(F)c(F)c2F)c2cnn(Cc3ccco3)c2N1 |
| InChI | InChI=1S/C17H12F3N3O2/c18-13-4-3-10(15(19)16(13)20)11-6-14(24)22-17-12(11)7-21-23(17)8-9-2-1-5-25-9/h1-5,7,11H,6,8H2,(H,22,24)/t11-/m1/s1 |
| InChIKey | ONUVNTIOFCLWGF-LLVKDONJSA-N |
| XLogP | 3.42 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|