C31H20BrClN4O4 — CID 136899916
6-bromo-3-[(3S)-2-(2-chlorobenzoyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]-4-phenyl-1H-quinolin-2-one (PubChem CID 136899916) has the molecular formula C31H20BrClN4O4 and a molecular weight of 627.88 g/mol. Its IUPAC name is 6-bromo-3-[(3S)-2-(2-chlorobenzoyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]-4-phenyl-1H-quinolin-2-one.
| Compound Name | 6-bromo-3-[(3S)-2-(2-chlorobenzoyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 136899916 |
| Molecular Formula | C31H20BrClN4O4 |
| Molecular Weight | 627.88 g/mol |
| Exact Mass | 626.04 |
| IUPAC Name | 6-bromo-3-[(3S)-2-(2-chlorobenzoyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]-4-phenyl-1H-quinolin-2-one |
| SMILES | O=C(c1ccccc1Cl)N1N=C(c2c(-c3ccccc3)c3cc(Br)ccc3[nH]c2=O)C[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H20BrClN4O4/c32-20-13-14-25-23(16-20)28(18-7-2-1-3-8-18)29(30(38)34-25)26-17-27(19-9-6-10-21(15-19)37(40)41)36(35-26)31(39)22-11-4-5-12-24(22)33/h1-16,27H,17H2,(H,34,38)/t27-/m0/s1 |
| InChIKey | YYQYWLHJQBGYRV-MHZLTWQESA-N |
| XLogP | 7.51 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.88 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|