C42H46N4O10 — CID 136900111
(4R,9R,17S,22S)-27-[(2,4-dinitrophenyl)diazenyl]-9,17-diphenyl-3,10,13,16,23-pentaoxatetracyclo[23.3.1.04,9.017,22]nonacosa-1(28),25(29),26-trien-29-ol (PubChem CID 136900111) has the molecular formula C42H46N4O10 and a molecular weight of 766.85 g/mol. Its IUPAC name is (4R,9R,17S,22S)-27-[(2,4-dinitrophenyl)diazenyl]-9,17-diphenyl-3,10,13,16,23-pentaoxatetracyclo[23.3.1.04,9.017,22]nonacosa-1(28),25(29),26-trien-29-ol.
| Compound Name | (4R,9R,17S,22S)-27-[(2,4-dinitrophenyl)diazenyl]-9,17-diphenyl-3,10,13,16,23-pentaoxatetracyclo[23.3.1.04,9.017,22]nonacosa-1(28),25(29),26-trien-29-ol |
|---|---|
| PubChem CID | 136900111 |
| Molecular Formula | C42H46N4O10 |
| Molecular Weight | 766.85 g/mol |
| Exact Mass | 766.32 |
| IUPAC Name | (4R,9R,17S,22S)-27-[(2,4-dinitrophenyl)diazenyl]-9,17-diphenyl-3,10,13,16,23-pentaoxatetracyclo[23.3.1.04,9.017,22]nonacosa-1(28),25(29),26-trien-29-ol |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2cc3c(O)c(c2)CO[C@@H]2CCCC[C@]2(c2ccccc2)OCCOCCO[C@]2(c4ccccc4)CCCC[C@@H]2OC3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C42H46N4O10/c47-40-30-25-34(43-44-36-18-17-35(45(48)49)27-37(36)46(50)51)26-31(40)29-54-39-16-8-10-20-42(39,33-13-5-2-6-14-33)56-24-22-52-21-23-55-41(32-11-3-1-4-12-32)19-9-7-15-38(41)53-28-30/h1-6,11-14,17-18,25-27,38-39,47H,7-10,15-16,19-24,28-29H2/b44-43+/t38-,39+,41-,42+ |
| InChIKey | DJZRTNRLJXOWHF-WDDOQQNYSA-N |
| XLogP | 9.40 |
| TPSA | 177.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.85 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|