C9H15N5O2 — CID 136900914
5-amino-4-[[(4S)-4-methoxypyrrolidin-3-yl]amino]-1H-pyrimidin-6-one (PubChem CID 136900914) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 5-amino-4-[[(4S)-4-methoxypyrrolidin-3-yl]amino]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[[(4S)-4-methoxypyrrolidin-3-yl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136900914 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 5-amino-4-[[(4S)-4-methoxypyrrolidin-3-yl]amino]-1H-pyrimidin-6-one |
| SMILES | CO[C@H]1CNCC1Nc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C9H15N5O2/c1-16-6-3-11-2-5(6)14-8-7(10)9(15)13-4-12-8/h4-6,11H,2-3,10H2,1H3,(H2,12,13,14,15)/t5?,6-/m0/s1 |
| InChIKey | AWPGZSYWWZWJJL-GDVGLLTNSA-N |
| XLogP | -1.25 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |