C10H16ClN3O2 — CID 136901130
5-chloro-4-[(5-hydroxy-4-methylpentyl)amino]-1H-pyrimidin-6-one (PubChem CID 136901130) has the molecular formula C10H16ClN3O2 and a molecular weight of 245.71 g/mol. Its IUPAC name is 5-chloro-4-[(5-hydroxy-4-methylpentyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[(5-hydroxy-4-methylpentyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136901130 |
| Molecular Formula | C10H16ClN3O2 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 5-chloro-4-[(5-hydroxy-4-methylpentyl)amino]-1H-pyrimidin-6-one |
| SMILES | CC(CO)CCCNc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C10H16ClN3O2/c1-7(5-15)3-2-4-12-9-8(11)10(16)14-6-13-9/h6-7,15H,2-5H2,1H3,(H2,12,13,14,16) |
| InChIKey | AROZJOLAIRSWAK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|