C9H14BrN3O2S — CID 136901133
5-bromo-4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136901133) has the molecular formula C9H14BrN3O2S and a molecular weight of 308.20 g/mol. Its IUPAC name is 5-bromo-4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136901133 |
| Molecular Formula | C9H14BrN3O2S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 5-bromo-4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-1H-pyrimidin-6-one |
| SMILES | CSC(CO)C(C)Nc1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C9H14BrN3O2S/c1-5(6(3-14)16-2)13-8-7(10)9(15)12-4-11-8/h4-6,14H,3H2,1-2H3,(H2,11,12,13,15) |
| InChIKey | JAAWTVUYWZNBHT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |