C17H20O — CID 136901487
[(1R,2S)-2-benzyl-1-deuterio-3-methoxypropyl]benzene (PubChem CID 136901487) has the molecular formula C17H20O and a molecular weight of 241.35 g/mol. Its IUPAC name is [(1R,2S)-2-benzyl-1-deuterio-3-methoxypropyl]benzene.
| Compound Name | [(1R,2S)-2-benzyl-1-deuterio-3-methoxypropyl]benzene |
|---|---|
| PubChem CID | 136901487 |
| Molecular Formula | C17H20O |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | [(1R,2S)-2-benzyl-1-deuterio-3-methoxypropyl]benzene |
| SMILES | [2H][C@@H](c1ccccc1)[C@@H](COC)Cc1ccccc1 |
| InChI | InChI=1S/C17H20O/c1-18-14-17(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16/h2-11,17H,12-14H2,1H3/i12D/t12-,17+/m0/s1 |
| InChIKey | UKVIZVCGMKDZBK-GRNSFKHZSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |