About 8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol
8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol (PubChem CID 136901645) has the molecular formula C19H11N2OS2+
and a molecular weight of 347.44 g/mol. Its IUPAC name is 8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol.
Molecular Properties
| Compound Name | 8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol |
| PubChem CID | 136901645 |
| Molecular Formula | C19H11N2OS2+ |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol |
| SMILES | Oc1ccc2cc3cc4cc(-c5ns[s+]n5)ccc4cc3cc2c1 |
| InChI | InChI=1S/C19H10N2OS2/c22-18-4-3-12-6-15-8-14-7-13(19-20-23-24-21-19)2-1-11(14)5-16(15)9-17(12)10-18/h1-10H/p+1 |
| InChIKey | FYFZUIKHLIMEEQ-UHFFFAOYSA-O |
| XLogP | 5.71 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol?
The IUPAC name of 8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol (CID 136901645) is 8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol.
What is the SMILES notation for 8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol?
The canonical SMILES for 8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol is Oc1ccc2cc3cc4cc(-c5ns[s+]n5)ccc4cc3cc2c1.
What is the InChIKey of 8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol?
The InChIKey is FYFZUIKHLIMEEQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H10N2OS2/c22-18-4-3-12-6-15-8-14-7-13(19-20-23-24-21-19)2-1-11(14)5-16(15)9-17(12)10-18/h1-10H/p+1.
What are the key properties of 8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol?
8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol has a molecular weight of 347.44 g/mol, XLogP of 5.71, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1,2,3,5-dithiadiazol-1-ium-4-yl)tetracen-2-ol is sourced from PubChem (CID 136901645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).