About 5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine
5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine (PubChem CID 136901692) has the molecular formula C27H28N3+
and a molecular weight of 394.54 g/mol. Its IUPAC name is 5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine.
Molecular Properties
| Compound Name | 5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine |
| PubChem CID | 136901692 |
| Molecular Formula | C27H28N3+ |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine |
| SMILES | C#CCCCCCC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21 |
| InChI | InChI=1S/C27H27N3/c1-2-3-4-5-6-10-17-30-26-19-22(29)14-16-24(26)23-15-13-21(28)18-25(23)27(30)20-11-8-7-9-12-20/h1,7-9,11-16,18-19,29H,3-6,10,17,28H2/p+1 |
| InChIKey | APLQLTZEFQXLCJ-UHFFFAOYSA-O |
| XLogP | 5.70 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine?
The IUPAC name of 5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine (CID 136901692) is 5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine.
What is the SMILES notation for 5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine?
The canonical SMILES for 5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine is C#CCCCCCC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21.
What is the InChIKey of 5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine?
The InChIKey is APLQLTZEFQXLCJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C27H27N3/c1-2-3-4-5-6-10-17-30-26-19-22(29)14-16-24(26)23-15-13-21(28)18-25(23)27(30)20-11-8-7-9-12-20/h1,7-9,11-16,18-19,29H,3-6,10,17,28H2/p+1.
What are the key properties of 5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine?
5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine has a molecular weight of 394.54 g/mol, XLogP of 5.70, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oct-7-ynyl-6-phenylphenanthridin-5-ium-3,8-diamine is sourced from PubChem (CID 136901692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).