C64H66N4O4 — CID 136901894
methyl 4-[10,20-bis(3,5-ditert-butylphenyl)-15-(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 136901894) has the molecular formula C64H66N4O4 and a molecular weight of 955.26 g/mol. Its IUPAC name is methyl 4-[10,20-bis(3,5-ditert-butylphenyl)-15-(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[10,20-bis(3,5-ditert-butylphenyl)-15-(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 136901894 |
| Molecular Formula | C64H66N4O4 |
| Molecular Weight | 955.26 g/mol |
| Exact Mass | 954.51 |
| IUPAC Name | methyl 4-[10,20-bis(3,5-ditert-butylphenyl)-15-(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc([nH]4)c(-c4ccc(C(=O)OC)cc4)c4nc(c(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C64H66N4O4/c1-61(2,3)43-31-41(32-44(35-43)62(4,5)6)57-51-27-23-47(65-51)55(37-15-19-39(20-16-37)59(69)71-13)49-25-29-53(67-49)58(42-33-45(63(7,8)9)36-46(34-42)64(10,11)12)54-30-26-50(68-54)56(48-24-28-52(57)66-48)38-17-21-40(22-18-38)60(70)72-14/h15-36,65,68H,1-14H3/b55-47-,55-49-,56-48-,56-50-,57-51-,57-52-,58-53-,58-54- |
| InChIKey | GEXNMVGTRPLSDI-UJNHEQPASA-N |
| XLogP | 16.09 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.26 |
| LogP ≤ 5 | 16.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |