C20H22N6O5S — CID 136902178
5-[(7R)-7-(2,4-dimethoxyphenyl)-2-methylsulfanyl-6,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 136902178) has the molecular formula C20H22N6O5S and a molecular weight of 458.50 g/mol. Its IUPAC name is 5-[(7R)-7-(2,4-dimethoxyphenyl)-2-methylsulfanyl-6,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[(7R)-7-(2,4-dimethoxyphenyl)-2-methylsulfanyl-6,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136902178 |
| Molecular Formula | C20H22N6O5S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 5-[(7R)-7-(2,4-dimethoxyphenyl)-2-methylsulfanyl-6,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | COc1ccc([C@H]2CC(c3c(O)n(C)c(=O)n(C)c3=O)=Nc3nc(SC)nn32)c(OC)c1 |
| InChI | InChI=1S/C20H22N6O5S/c1-24-16(27)15(17(28)25(2)20(24)29)12-9-13(26-18(21-12)22-19(23-26)32-5)11-7-6-10(30-3)8-14(11)31-4/h6-8,13,27H,9H2,1-5H3/t13-/m1/s1 |
| InChIKey | MSRBMZDFUYWFOO-CYBMUJFWSA-N |
| XLogP | 1.23 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |