C19H22N4O3 — CID 136902704
4-[5-[(R)-amino-(3,4-diethoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]phenol (PubChem CID 136902704) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-[5-[(R)-amino-(3,4-diethoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]phenol.
| Compound Name | 4-[5-[(R)-amino-(3,4-diethoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]phenol |
|---|---|
| PubChem CID | 136902704 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 4-[5-[(R)-amino-(3,4-diethoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]phenol |
| SMILES | CCOc1ccc([C@@H](N)c2nc(-c3ccc(O)cc3)n[nH]2)cc1OCC |
| InChI | InChI=1S/C19H22N4O3/c1-3-25-15-10-7-13(11-16(15)26-4-2)17(20)19-21-18(22-23-19)12-5-8-14(24)9-6-12/h5-11,17,24H,3-4,20H2,1-2H3,(H,21,22,23)/t17-/m1/s1 |
| InChIKey | CCYRGKVBZGMAKP-QGZVFWFLSA-N |
| XLogP | 3.02 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |