About 2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one
2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one (PubChem CID 136903813) has the molecular formula C11H9N5O3
and a molecular weight of 259.23 g/mol. Its IUPAC name is 2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one |
| PubChem CID | 136903813 |
| Molecular Formula | C11H9N5O3 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one |
| SMILES | Nc1nc2nc(-c3cc(O)ccc3O)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C11H9N5O3/c12-11-15-9-7(10(19)16-11)13-8(14-9)5-3-4(17)1-2-6(5)18/h1-3,17-18H,(H4,12,13,14,15,16,19) |
| InChIKey | UGRJPKLIQNQDNL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 140.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one?
The IUPAC name of 2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one (CID 136903813) is 2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one.
What is the SMILES notation for 2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one?
The canonical SMILES for 2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one is Nc1nc2nc(-c3cc(O)ccc3O)[nH]c2c(=O)[nH]1.
What is the InChIKey of 2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one?
The InChIKey is UGRJPKLIQNQDNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5O3/c12-11-15-9-7(10(19)16-11)13-8(14-9)5-3-4(17)1-2-6(5)18/h1-3,17-18H,(H4,12,13,14,15,16,19).
What are the key properties of 2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one?
2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one has a molecular weight of 259.23 g/mol, XLogP of 0.31, 1 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-8-(2,5-dihydroxyphenyl)-1,7-dihydropurin-6-one is sourced from PubChem (CID 136903813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).