C13H8ClN3O4 — CID 136903971
8-chloro-3-(2,5-dihydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid (PubChem CID 136903971) has the molecular formula C13H8ClN3O4 and a molecular weight of 305.68 g/mol. Its IUPAC name is 8-chloro-3-(2,5-dihydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid.
| Compound Name | 8-chloro-3-(2,5-dihydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 136903971 |
| Molecular Formula | C13H8ClN3O4 |
| Molecular Weight | 305.68 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 8-chloro-3-(2,5-dihydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)c2nnc(-c3cc(O)ccc3O)n2c1 |
| InChI | InChI=1S/C13H8ClN3O4/c14-9-3-6(13(20)21)5-17-11(15-16-12(9)17)8-4-7(18)1-2-10(8)19/h1-5,18-19H,(H,20,21) |
| InChIKey | NQUDVRGPCWSQFD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.68 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|