C14H16N2O5 — CID 136904298
4-[3-(4-methoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol (PubChem CID 136904298) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-[3-(4-methoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol.
| Compound Name | 4-[3-(4-methoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136904298 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-[3-(4-methoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol |
| SMILES | COC1(c2noc(-c3ccc(O)cc3O)n2)CCOCC1 |
| InChI | InChI=1S/C14H16N2O5/c1-19-14(4-6-20-7-5-14)13-15-12(21-16-13)10-3-2-9(17)8-11(10)18/h2-3,8,17-18H,4-7H2,1H3 |
| InChIKey | HEZACRYJAJUOBS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |